C10H11B6N3 — CID 167645226
CID 167645226 (PubChem CID 167645226) has the molecular formula C10H11B6N3 and a molecular weight of 238.09 g/mol.
| Compound Name | CID 167645226 |
|---|---|
| PubChem CID | 167645226 |
| Molecular Formula | C10H11B6N3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | — |
| SMILES | [B]B([B])B([B])[B].[N-]=[N+]=NC1CCCc2ccccc21 |
| InChI | InChI=1S/C10H11N3.B6/c11-13-12-10-7-3-5-8-4-1-2-6-9(8)10;1-5(2)6(3)4/h1-2,4,6,10H,3,5,7H2; |
| InChIKey | YQLGSDWOUSWYDT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|