C22H24N2O — CID 163644776
1,2,3,4-tetrahydronaphthalen-1-yliminomethyl N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanimidate (PubChem CID 163644776) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yliminomethyl N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanimidate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yliminomethyl N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanimidate |
|---|---|
| PubChem CID | 163644776 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yliminomethyl N-(1,2,3,4-tetrahydronaphthalen-1-yl)methanimidate |
| SMILES | C(=N/C1CCCc2ccccc21)\O/C=N/C1CCCc2ccccc21 |
| InChI | InChI=1S/C22H24N2O/c1-3-11-19-17(7-1)9-5-13-21(19)23-15-25-16-24-22-14-6-10-18-8-2-4-12-20(18)22/h1-4,7-8,11-12,15-16,21-22H,5-6,9-10,13-14H2/b23-15+,24-16+ |
| InChIKey | IHHYWKHAIABDMI-DFEHQXHXSA-N |
| XLogP | 5.21 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|