C29H32O4Si — CID 54011243
ethyl 5-[tert-butyl(diphenyl)silyl]oxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate (PubChem CID 54011243) has the molecular formula C29H32O4Si and a molecular weight of 472.66 g/mol. Its IUPAC name is ethyl 5-[tert-butyl(diphenyl)silyl]oxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate.
| Compound Name | ethyl 5-[tert-butyl(diphenyl)silyl]oxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54011243 |
| Molecular Formula | C29H32O4Si |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | ethyl 5-[tert-butyl(diphenyl)silyl]oxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cccc2C1=O |
| InChI | InChI=1S/C29H32O4Si/c1-5-32-28(31)25-20-19-23-24(27(25)30)17-12-18-26(23)33-34(29(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-18,25H,5,19-20H2,1-4H3 |
| InChIKey | KSNCDQIYGSDTTL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|