C32H34N2O3SSi — CID 87787954
N-[(E)-[4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 87787954) has the molecular formula C32H34N2O3SSi and a molecular weight of 554.79 g/mol. Its IUPAC name is N-[(E)-[4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 87787954 |
| Molecular Formula | C32H34N2O3SSi |
| Molecular Weight | 554.79 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-[(E)-[4-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CCc3c(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)cccc32)cc1 |
| InChI | InChI=1S/C32H34N2O3SSi/c1-24-18-20-25(21-19-24)38(35,36)34-33-30-23-22-29-28(30)16-11-17-31(29)37-39(32(2,3)4,26-12-7-5-8-13-26)27-14-9-6-10-15-27/h5-21,34H,22-23H2,1-4H3/b33-30+ |
| InChIKey | OUJQKQHNINVPKL-KKYHWDRJSA-N |
| XLogP | 5.56 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.79 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|