C30H35NO4S2Si — CID 86753745
tert-butyl-diphenyl-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)silane;4-methylbenzenesulfonic acid (PubChem CID 86753745) has the molecular formula C30H35NO4S2Si and a molecular weight of 565.83 g/mol. Its IUPAC name is tert-butyl-diphenyl-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)silane;4-methylbenzenesulfonic acid.
| Compound Name | tert-butyl-diphenyl-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)silane;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86753745 |
| Molecular Formula | C30H35NO4S2Si |
| Molecular Weight | 565.83 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | tert-butyl-diphenyl-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yloxy)silane;4-methylbenzenesulfonic acid |
| SMILES | CC(C)(C)[Si](Oc1cc2c(s1)CCNC2)(c1ccccc1)c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H27NOSSi.C7H8O3S/c1-23(2,3)27(19-10-6-4-7-11-19,20-12-8-5-9-13-20)25-22-16-18-17-24-15-14-21(18)26-22;1-6-2-4-7(5-3-6)11(8,9)10/h4-13,16,24H,14-15,17H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | CTYPWFYAXQGGCY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.83 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|