C28H36O4SSi — CID 87673111
3-[4-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylbenzenesulfonic acid (PubChem CID 87673111) has the molecular formula C28H36O4SSi and a molecular weight of 496.75 g/mol. Its IUPAC name is 3-[4-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylbenzenesulfonic acid.
| Compound Name | 3-[4-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87673111 |
| Molecular Formula | C28H36O4SSi |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-[4-[tert-butyl(diphenyl)silyl]oxypentyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1CCCC(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36O4SSi/c1-22-19-20-25(33(29,30)31)21-24(22)14-12-13-23(2)32-34(28(3,4)5,26-15-8-6-9-16-26)27-17-10-7-11-18-27/h6-11,15-21,23H,12-14H2,1-5H3,(H,29,30,31) |
| InChIKey | DMGHABRKPNLOAI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|