C22H30N2O3SSi — CID 23539545
N-[(Z)-[4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 23539545) has the molecular formula C22H30N2O3SSi and a molecular weight of 430.65 g/mol. Its IUPAC name is N-[(Z)-[4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23539545 |
| Molecular Formula | C22H30N2O3SSi |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[(Z)-[4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroinden-1-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/CCc3c(O[Si](C)(C)C(C)(C)C)cccc32)cc1 |
| InChI | InChI=1S/C22H30N2O3SSi/c1-16-10-12-17(13-11-16)28(25,26)24-23-20-15-14-19-18(20)8-7-9-21(19)27-29(5,6)22(2,3)4/h7-13,24H,14-15H2,1-6H3/b23-20- |
| InChIKey | TUOYZGAOLRUOIO-ATJXCDBQSA-N |
| XLogP | 5.01 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|