C16H14F2N2O3S — CID 174143733
N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 174143733) has the molecular formula C16H14F2N2O3S and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 174143733 |
| Molecular Formula | C16H14F2N2O3S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2CCOc3c2ccc(F)c3F)cc1 |
| InChI | InChI=1S/C16H14F2N2O3S/c1-10-2-4-11(5-3-10)24(21,22)20-19-14-8-9-23-16-12(14)6-7-13(17)15(16)18/h2-7,20H,8-9H2,1H3 |
| InChIKey | UWIZPAYKGVDGOH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|