C17H14F2N2O2 — CID 175481764
N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzamide (PubChem CID 175481764) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzamide.
| Compound Name | N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 175481764 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[(7,8-difluoro-2,3-dihydrochromen-4-ylidene)amino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN=C2CCOc3c2ccc(F)c3F)cc1 |
| InChI | InChI=1S/C17H14F2N2O2/c1-10-2-4-11(5-3-10)17(22)21-20-14-8-9-23-16-12(14)6-7-13(18)15(16)19/h2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | BTMGABWPFVTGBG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|