C23H40N2O5SSi — CID 164675486
N-[(E)-[(2R)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2-methylcyclopentylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 164675486) has the molecular formula C23H40N2O5SSi and a molecular weight of 484.74 g/mol. Its IUPAC name is N-[(E)-[(2R)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2-methylcyclopentylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[(2R)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2-methylcyclopentylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164675486 |
| Molecular Formula | C23H40N2O5SSi |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-[(E)-[(2R)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)ethyl]-2-methylcyclopentylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | COCO[C@@H](CO[Si](C)(C)C(C)(C)C)[C@]1(C)CCC/C1=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H40N2O5SSi/c1-18-11-13-19(14-12-18)31(26,27)25-24-20-10-9-15-23(20,5)21(29-17-28-6)16-30-32(7,8)22(2,3)4/h11-14,21,25H,9-10,15-17H2,1-8H3/b24-20+/t21-,23+/m0/s1 |
| InChIKey | OWSSNJAWDGKDNN-SOTKTIDJSA-N |
| XLogP | 4.83 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|