C18H24N2O4S — CID 6374487
(3Z)-4,7,7-trimethyl-3-[(4-methylphenyl)sulfonylhydrazinylidene]bicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 6374487) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (3Z)-4,7,7-trimethyl-3-[(4-methylphenyl)sulfonylhydrazinylidene]bicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (3Z)-4,7,7-trimethyl-3-[(4-methylphenyl)sulfonylhydrazinylidene]bicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 6374487 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (3Z)-4,7,7-trimethyl-3-[(4-methylphenyl)sulfonylhydrazinylidene]bicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/CC3(C(=O)O)CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-12-5-7-13(8-6-12)25(23,24)20-19-14-11-18(15(21)22)10-9-17(14,4)16(18,2)3/h5-8,20H,9-11H2,1-4H3,(H,21,22)/b19-14- |
| InChIKey | JIQMYMMTJYOGTD-RGEXLXHISA-N |
| XLogP | 2.93 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|