C15H20N2O2S2 — CID 134973307
N-[(E)-(2,2-dimethyl-4-propan-2-ylidenethietan-3-ylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 134973307) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is N-[(E)-(2,2-dimethyl-4-propan-2-ylidenethietan-3-ylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-(2,2-dimethyl-4-propan-2-ylidenethietan-3-ylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134973307 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[(E)-(2,2-dimethyl-4-propan-2-ylidenethietan-3-ylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | CC(C)=C1SC(C)(C)/C1=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20N2O2S2/c1-10(2)13-14(15(4,5)20-13)16-17-21(18,19)12-8-6-11(3)7-9-12/h6-9,17H,1-5H3/b16-14- |
| InChIKey | YQBRACNFEYZDJW-PEZBUJJGSA-N |
| XLogP | 3.45 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|