C10H11Cl3N2O2S — CID 134897096
4-methyl-N-[(E)-1,1,1-trichloropropan-2-ylideneamino]benzenesulfonamide (PubChem CID 134897096) has the molecular formula C10H11Cl3N2O2S and a molecular weight of 329.64 g/mol. Its IUPAC name is 4-methyl-N-[(E)-1,1,1-trichloropropan-2-ylideneamino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-1,1,1-trichloropropan-2-ylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 134897096 |
| Molecular Formula | C10H11Cl3N2O2S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 4-methyl-N-[(E)-1,1,1-trichloropropan-2-ylideneamino]benzenesulfonamide |
| SMILES | C/C(=N\NS(=O)(=O)c1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H11Cl3N2O2S/c1-7-3-5-9(6-4-7)18(16,17)15-14-8(2)10(11,12)13/h3-6,15H,1-2H3/b14-8+ |
| InChIKey | ARVWMMNSLSSKPP-RIYZIHGNSA-N |
| XLogP | 3.02 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|