C13H12F6N2O2S — CID 10926847
4-methyl-N-[(Z)-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-ylidene]amino]benzenesulfonamide (PubChem CID 10926847) has the molecular formula C13H12F6N2O2S and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(Z)-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 10926847 |
| Molecular Formula | C13H12F6N2O2S |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 4-methyl-N-[(Z)-[5,5,5-trifluoro-4-(trifluoromethyl)pent-3-en-2-ylidene]amino]benzenesulfonamide |
| SMILES | C/C(C=C(C(F)(F)F)C(F)(F)F)=N/NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H12F6N2O2S/c1-8-3-5-10(6-4-8)24(22,23)21-20-9(2)7-11(12(14,15)16)13(17,18)19/h3-7,21H,1-2H3/b20-9- |
| InChIKey | XVDRVAVLROFXBH-UKWGHVSLSA-N |
| XLogP | 3.70 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|