C14H22N2O2S — CID 165343830
N-(2,2-dimethylpentan-3-ylideneamino)-4-methylbenzenesulfonamide (PubChem CID 165343830) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(2,2-dimethylpentan-3-ylideneamino)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethylpentan-3-ylideneamino)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 165343830 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(2,2-dimethylpentan-3-ylideneamino)-4-methylbenzenesulfonamide |
| SMILES | CCC(=NNS(=O)(=O)c1ccc(C)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H22N2O2S/c1-6-13(14(3,4)5)15-16-19(17,18)12-9-7-11(2)8-10-12/h7-10,16H,6H2,1-5H3 |
| InChIKey | QWEDNFJRCQBXHX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|