C16H24N2O3S — CID 143285935
N-[(E)-(5,5-dimethyl-7-oxoheptan-3-ylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 143285935) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[(E)-(5,5-dimethyl-7-oxoheptan-3-ylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-(5,5-dimethyl-7-oxoheptan-3-ylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 143285935 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(E)-(5,5-dimethyl-7-oxoheptan-3-ylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | CC/C(CC(C)(C)CC=O)=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-5-14(12-16(3,4)10-11-19)17-18-22(20,21)15-8-6-13(2)7-9-15/h6-9,11,18H,5,10,12H2,1-4H3/b17-14+ |
| InChIKey | ASBUDNDXNCCGMK-SAPNQHFASA-N |
| XLogP | 3.04 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|