C11H14Cl2N2O2S — CID 11278280
N-[(E)-1,1-dichlorobutan-2-ylideneamino]-4-methylbenzenesulfonamide (PubChem CID 11278280) has the molecular formula C11H14Cl2N2O2S and a molecular weight of 309.22 g/mol. Its IUPAC name is N-[(E)-1,1-dichlorobutan-2-ylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-1,1-dichlorobutan-2-ylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11278280 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-[(E)-1,1-dichlorobutan-2-ylideneamino]-4-methylbenzenesulfonamide |
| SMILES | CC/C(=N\NS(=O)(=O)c1ccc(C)cc1)C(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2N2O2S/c1-3-10(11(12)13)14-15-18(16,17)9-6-4-8(2)5-7-9/h4-7,11,15H,3H2,1-2H3/b14-10+ |
| InChIKey | VIMGLDZZIIFJSM-GXDHUFHOSA-N |
| XLogP | 2.84 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|