C12H17ClN2O3S — CID 102345754
N-[(2E)-3-chloro-2-methoxyiminobutyl]-4-methylbenzenesulfonamide (PubChem CID 102345754) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is N-[(2E)-3-chloro-2-methoxyiminobutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2E)-3-chloro-2-methoxyiminobutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102345754 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-[(2E)-3-chloro-2-methoxyiminobutyl]-4-methylbenzenesulfonamide |
| SMILES | CO/N=C(\CNS(=O)(=O)c1ccc(C)cc1)C(C)Cl |
| InChI | InChI=1S/C12H17ClN2O3S/c1-9-4-6-11(7-5-9)19(16,17)14-8-12(10(2)13)15-18-3/h4-7,10,14H,8H2,1-3H3/b15-12+ |
| InChIKey | BOXHUPXFUFROGB-NTCAYCPXSA-N |
| XLogP | 1.90 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|