C19H23N5O5S2 — CID 136734384
N-[(Z)-[(4E)-3-hydroxyimino-4-[(4-methylphenyl)sulfonylhydrazinylidene]pentan-2-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 136734384) has the molecular formula C19H23N5O5S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[(Z)-[(4E)-3-hydroxyimino-4-[(4-methylphenyl)sulfonylhydrazinylidene]pentan-2-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(4E)-3-hydroxyimino-4-[(4-methylphenyl)sulfonylhydrazinylidene]pentan-2-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 136734384 |
| Molecular Formula | C19H23N5O5S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[(Z)-[(4E)-3-hydroxyimino-4-[(4-methylphenyl)sulfonylhydrazinylidene]pentan-2-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | CC(=N/NS(=O)(=O)c1ccc(C)cc1)/C(=N/O)C(/C)=N/NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N5O5S2/c1-13-5-9-17(10-6-13)30(26,27)23-20-15(3)19(22-25)16(4)21-24-31(28,29)18-11-7-14(2)8-12-18/h5-12,23-25H,1-4H3/b20-15-,21-16+,22-19- |
| InChIKey | PTTHDPNMEMGSNC-PZPGQKTASA-N |
| XLogP | 2.14 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|