C15H23N2O5PS — CID 134877215
N-[(Z)-(1-dimethoxyphosphoryl-2,3-dimethylbut-2-enylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 134877215) has the molecular formula C15H23N2O5PS and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[(Z)-(1-dimethoxyphosphoryl-2,3-dimethylbut-2-enylidene)amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-(1-dimethoxyphosphoryl-2,3-dimethylbut-2-enylidene)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134877215 |
| Molecular Formula | C15H23N2O5PS |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[(Z)-(1-dimethoxyphosphoryl-2,3-dimethylbut-2-enylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | COP(=O)(OC)/C(=N\NS(=O)(=O)c1ccc(C)cc1)C(C)=C(C)C |
| InChI | InChI=1S/C15H23N2O5PS/c1-11(2)13(4)15(23(18,21-5)22-6)16-17-24(19,20)14-9-7-12(3)8-10-14/h7-10,17H,1-6H3/b16-15- |
| InChIKey | AOYWQFOBUSFYOS-NXVVXOECSA-N |
| XLogP | 3.43 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|