C19H26N2O2S — CID 561246
N-[1-(1-adamantyl)ethylideneamino]-4-methylbenzenesulfonamide (PubChem CID 561246) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(1-adamantyl)ethylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 561246 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[1-(1-adamantyl)ethylideneamino]-4-methylbenzenesulfonamide |
| SMILES | CC(=NNS(=O)(=O)c1ccc(C)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26N2O2S/c1-13-3-5-18(6-4-13)24(22,23)21-20-14(2)19-10-15-7-16(11-19)9-17(8-15)12-19/h3-6,15-17,21H,7-12H2,1-2H3 |
| InChIKey | ZRSKZWIXAGMHOK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|