C17H22N2O2 — CID 98145922
(1S,3Z,4S)-3-hydroxyimino-4,7,7-trimethyl-N-phenylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98145922) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (1S,3Z,4S)-3-hydroxyimino-4,7,7-trimethyl-N-phenylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,3Z,4S)-3-hydroxyimino-4,7,7-trimethyl-N-phenylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98145922 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1S,3Z,4S)-3-hydroxyimino-4,7,7-trimethyl-N-phenylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@]2(C(=O)Nc3ccccc3)CC[C@]1(C)/C(=N\O)C2 |
| InChI | InChI=1S/C17H22N2O2/c1-15(2)16(3)9-10-17(15,11-13(16)19-21)14(20)18-12-7-5-4-6-8-12/h4-8,21H,9-11H2,1-3H3,(H,18,20)/b19-13-/t16-,17-/m1/s1 |
| InChIKey | GMDDGXQMEVEING-JJLAUHSJSA-N |
| XLogP | 3.67 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|