C25H30N2O2 — CID 18830162
(3E)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 18830162) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (3E)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (3E)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 18830162 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (3E)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)N(Cc3ccccc3)Cc3ccccc3)(C/C1=N\O)C2(C)C |
| InChI | InChI=1S/C25H30N2O2/c1-23(2)24(3)14-15-25(23,16-21(24)26-29)22(28)27(17-19-10-6-4-7-11-19)18-20-12-8-5-9-13-20/h4-13,29H,14-18H2,1-3H3/b26-21+ |
| InChIKey | BUDMUEDTOHCFAV-YYADALCUSA-N |
| XLogP | 5.26 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|