C25H28N2O3 — CID 6416641
(3Z)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 6416641) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3Z)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (3Z)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 6416641 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (3Z)-N,N-dibenzyl-3-hydroxyimino-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)N(Cc3ccccc3)Cc3ccccc3)(C(=O)/C1=N\O)C2(C)C |
| InChI | InChI=1S/C25H28N2O3/c1-23(2)24(3)14-15-25(23,21(28)20(24)26-30)22(29)27(16-18-10-6-4-7-11-18)17-19-12-8-5-9-13-19/h4-13,30H,14-17H2,1-3H3/b26-20+ |
| InChIKey | MOOXKOCVAOKNOC-LHLOQNFPSA-N |
| XLogP | 4.44 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|