C19H25NO — CID 11022412
N-benzyl-N-butyl-1-methylcyclohexa-2,5-diene-1-carboxamide (PubChem CID 11022412) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is N-benzyl-N-butyl-1-methylcyclohexa-2,5-diene-1-carboxamide.
| Compound Name | N-benzyl-N-butyl-1-methylcyclohexa-2,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 11022412 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-benzyl-N-butyl-1-methylcyclohexa-2,5-diene-1-carboxamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)C1(C)C=CCC=C1 |
| InChI | InChI=1S/C19H25NO/c1-3-4-15-20(16-17-11-7-5-8-12-17)18(21)19(2)13-9-6-10-14-19/h5,7-14H,3-4,6,15-16H2,1-2H3 |
| InChIKey | YLPRQFCKQLEAOK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|