C27H32N2O — CID 71318039
1,3-dibenzyl-1-butyl-3-(2,4-dimethylphenyl)urea (PubChem CID 71318039) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1,3-dibenzyl-1-butyl-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1,3-dibenzyl-1-butyl-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 71318039 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1,3-dibenzyl-1-butyl-3-(2,4-dimethylphenyl)urea |
| SMILES | CCCCN(Cc1ccccc1)C(=O)N(Cc1ccccc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C27H32N2O/c1-4-5-18-28(20-24-12-8-6-9-13-24)27(30)29(21-25-14-10-7-11-15-25)26-17-16-22(2)19-23(26)3/h6-17,19H,4-5,18,20-21H2,1-3H3 |
| InChIKey | NQYIWBNNPHOSSX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |