C24H26Br3NO — CID 4513009
N,N-dibenzyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4513009) has the molecular formula C24H26Br3NO and a molecular weight of 584.19 g/mol. Its IUPAC name is N,N-dibenzyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | N,N-dibenzyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4513009 |
| Molecular Formula | C24H26Br3NO |
| Molecular Weight | 584.19 g/mol |
| Exact Mass | 580.96 |
| IUPAC Name | N,N-dibenzyl-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC1(C)C2(C(=O)N(Cc3ccccc3)Cc3ccccc3)CCC1(C(Br)Br)C2Br |
| InChI | InChI=1S/C24H26Br3NO/c1-22(2)23(20(26)27)13-14-24(22,19(23)25)21(29)28(15-17-9-5-3-6-10-17)16-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3 |
| InChIKey | NDQJQWVKFXJELT-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.19 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|