C16H20N2O4 — CID 27307341
(1R,3Z,4S)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 27307341) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (1R,3Z,4S)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (1R,3Z,4S)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 27307341 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (1R,3Z,4S)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC1(C)[C@@]2(C(=O)O)CC[C@]1(C)/C(=N\NC(=O)c1ccco1)C2 |
| InChI | InChI=1S/C16H20N2O4/c1-14(2)15(3)6-7-16(14,13(20)21)9-11(15)17-18-12(19)10-5-4-8-22-10/h4-5,8H,6-7,9H2,1-3H3,(H,18,19)(H,20,21)/b17-11-/t15-,16+/m1/s1 |
| InChIKey | CVIUSHARRRYTTR-QIESAVBPSA-N |
| XLogP | 2.67 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|