C26H29ClN2O3 — CID 6198126
[(Z)-[4-[(3,5-dimethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-chlorobenzoate (PubChem CID 6198126) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is [(Z)-[4-[(3,5-dimethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-chlorobenzoate.
| Compound Name | [(Z)-[4-[(3,5-dimethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6198126 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [(Z)-[4-[(3,5-dimethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-chlorobenzoate |
| SMILES | Cc1cc(C)cc(NC(=O)C23CCC(C)(/C(=N\OC(=O)c4ccccc4Cl)C2)C3(C)C)c1 |
| InChI | InChI=1S/C26H29ClN2O3/c1-16-12-17(2)14-18(13-16)28-23(31)26-11-10-25(5,24(26,3)4)21(15-26)29-32-22(30)19-8-6-7-9-20(19)27/h6-9,12-14H,10-11,15H2,1-5H3,(H,28,31)/b29-21- |
| InChIKey | NXQRPUMWMGPTRR-ANYBSYGZSA-N |
| XLogP | 6.32 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|