C24H23Cl2FN2O3 — CID 4714804
[[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate (PubChem CID 4714804) has the molecular formula C24H23Cl2FN2O3 and a molecular weight of 477.36 g/mol. Its IUPAC name is [[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate.
| Compound Name | [[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4714804 |
| Molecular Formula | C24H23Cl2FN2O3 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | [[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate |
| SMILES | CC12CCC(C(=O)Nc3ccc(F)cc3)(CC1=NOC(=O)c1ccc(Cl)cc1Cl)C2(C)C |
| InChI | InChI=1S/C24H23Cl2FN2O3/c1-22(2)23(3)10-11-24(22,21(31)28-16-7-5-15(27)6-8-16)13-19(23)29-32-20(30)17-9-4-14(25)12-18(17)26/h4-9,12H,10-11,13H2,1-3H3,(H,28,31) |
| InChIKey | QPDMZNVUBMYGBD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|