C25H27FN2O3 — CID 4714797
[[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate (PubChem CID 4714797) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is [[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate.
| Compound Name | [[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 4714797 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [[4-[(4-fluorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)ON=C2CC3(C(=O)Nc4ccc(F)cc4)CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C25H27FN2O3/c1-16-5-7-17(8-6-16)21(29)31-28-20-15-25(14-13-24(20,4)23(25,2)3)22(30)27-19-11-9-18(26)10-12-19/h5-12H,13-15H2,1-4H3,(H,27,30) |
| InChIKey | GOCQMFOMZMBAGU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|