C26H29BrN2O3 — CID 6198192
[(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate (PubChem CID 6198192) has the molecular formula C26H29BrN2O3 and a molecular weight of 497.43 g/mol. Its IUPAC name is [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate.
| Compound Name | [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate |
|---|---|
| PubChem CID | 6198192 |
| Molecular Formula | C26H29BrN2O3 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate |
| SMILES | CCc1ccc(NC(=O)C23CCC(C)(/C(=N\OC(=O)c4ccc(Br)cc4)C2)C3(C)C)cc1 |
| InChI | InChI=1S/C26H29BrN2O3/c1-5-17-6-12-20(13-7-17)28-23(31)26-15-14-25(4,24(26,2)3)21(16-26)29-32-22(30)18-8-10-19(27)11-9-18/h6-13H,5,14-16H2,1-4H3,(H,28,31)/b29-21- |
| InChIKey | NBQUMJKGKGGITL-ANYBSYGZSA-N |
| XLogP | 6.38 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|