C29H30N2O5 — CID 6198199
[(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate (PubChem CID 6198199) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate.
| Compound Name | [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 6198199 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-oxochromene-3-carboxylate |
| SMILES | CCc1ccc(NC(=O)C23CCC(C)(/C(=N\OC(=O)c4cc5ccccc5oc4=O)C2)C3(C)C)cc1 |
| InChI | InChI=1S/C29H30N2O5/c1-5-18-10-12-20(13-11-18)30-26(34)29-15-14-28(4,27(29,2)3)23(17-29)31-36-25(33)21-16-19-8-6-7-9-22(19)35-24(21)32/h6-13,16H,5,14-15,17H2,1-4H3,(H,30,34)/b31-23- |
| InChIKey | CJLKJMBGMDKORO-SXBRIOAWSA-N |
| XLogP | 5.72 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|