C26H28N4O7 — CID 6198195
[(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate (PubChem CID 6198195) has the molecular formula C26H28N4O7 and a molecular weight of 508.53 g/mol. Its IUPAC name is [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate.
| Compound Name | [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 6198195 |
| Molecular Formula | C26H28N4O7 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [(Z)-[4-[(4-ethylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,5-dinitrobenzoate |
| SMILES | CCc1ccc(NC(=O)C23CCC(C)(/C(=N\OC(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)C2)C3(C)C)cc1 |
| InChI | InChI=1S/C26H28N4O7/c1-5-16-6-8-18(9-7-16)27-23(32)26-11-10-25(4,24(26,2)3)21(15-26)28-37-22(31)17-12-19(29(33)34)14-20(13-17)30(35)36/h6-9,12-14H,5,10-11,15H2,1-4H3,(H,27,32)/b28-21- |
| InChIKey | SMBPTMGXHSLDHR-HFTWOUSFSA-N |
| XLogP | 5.43 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|