C30H29N5O5 — CID 23428457
[(E)-[1,7,7-trimethyl-4-[(4-phenyldiazenylphenyl)carbamoyl]-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate (PubChem CID 23428457) has the molecular formula C30H29N5O5 and a molecular weight of 539.59 g/mol. Its IUPAC name is [(E)-[1,7,7-trimethyl-4-[(4-phenyldiazenylphenyl)carbamoyl]-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate.
| Compound Name | [(E)-[1,7,7-trimethyl-4-[(4-phenyldiazenylphenyl)carbamoyl]-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate |
|---|---|
| PubChem CID | 23428457 |
| Molecular Formula | C30H29N5O5 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | [(E)-[1,7,7-trimethyl-4-[(4-phenyldiazenylphenyl)carbamoyl]-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate |
| SMILES | CC12CCC(C(=O)Nc3ccc(/N=N/c4ccccc4)cc3)(C/C1=N\OC(=O)c1cccc([N+](=O)[O-])c1)C2(C)C |
| InChI | InChI=1S/C30H29N5O5/c1-28(2)29(3)16-17-30(28,19-25(29)34-40-26(36)20-8-7-11-24(18-20)35(38)39)27(37)31-21-12-14-23(15-13-21)33-32-22-9-5-4-6-10-22/h4-15,18H,16-17,19H2,1-3H3,(H,31,37)/b33-32+,34-25+ |
| InChIKey | HOAISTRWTLJFDA-PARHTJLUSA-N |
| XLogP | 7.38 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|