C24H24ClN3O5 — CID 4714668
[[4-[(2-chlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate (PubChem CID 4714668) has the molecular formula C24H24ClN3O5 and a molecular weight of 469.93 g/mol. Its IUPAC name is [[4-[(2-chlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate.
| Compound Name | [[4-[(2-chlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate |
|---|---|
| PubChem CID | 4714668 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [[4-[(2-chlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3-nitrobenzoate |
| SMILES | CC12CCC(C(=O)Nc3ccccc3Cl)(CC1=NOC(=O)c1cccc([N+](=O)[O-])c1)C2(C)C |
| InChI | InChI=1S/C24H24ClN3O5/c1-22(2)23(3)11-12-24(22,21(30)26-18-10-5-4-9-17(18)25)14-19(23)27-33-20(29)15-7-6-8-16(13-15)28(31)32/h4-10,13H,11-12,14H2,1-3H3,(H,26,30) |
| InChIKey | YQRCHUOLGDTALF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|