C26H28ClN3O6 — CID 4714241
[[4-[(2-methoxy-5-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate (PubChem CID 4714241) has the molecular formula C26H28ClN3O6 and a molecular weight of 513.98 g/mol. Its IUPAC name is [[4-[(2-methoxy-5-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate.
| Compound Name | [[4-[(2-methoxy-5-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 4714241 |
| Molecular Formula | C26H28ClN3O6 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | [[4-[(2-methoxy-5-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate |
| SMILES | COc1ccc(C)cc1NC(=O)C12CCC(C)(C(=NOC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C1)C2(C)C |
| InChI | InChI=1S/C26H28ClN3O6/c1-15-6-9-20(35-5)18(12-15)28-23(32)26-11-10-25(4,24(26,2)3)21(14-26)29-36-22(31)16-7-8-17(27)19(13-16)30(33)34/h6-9,12-13H,10-11,14H2,1-5H3,(H,28,32) |
| InChIKey | ZFUXOUYECAHSIC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|