C25H25Cl2N3O5 — CID 6198252
[(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate (PubChem CID 6198252) has the molecular formula C25H25Cl2N3O5 and a molecular weight of 518.40 g/mol. Its IUPAC name is [(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate.
| Compound Name | [(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 6198252 |
| Molecular Formula | C25H25Cl2N3O5 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | [(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-chloro-3-nitrobenzoate |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C12CCC(C)(/C(=N\OC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C1)C2(C)C |
| InChI | InChI=1S/C25H25Cl2N3O5/c1-14-11-16(26)6-8-18(14)28-22(32)25-10-9-24(4,23(25,2)3)20(13-25)29-35-21(31)15-5-7-17(27)19(12-15)30(33)34/h5-8,11-12H,9-10,13H2,1-4H3,(H,28,32)/b29-20- |
| InChIKey | AHMLWVLUGMKRTD-BRPDVVIDSA-N |
| XLogP | 6.58 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|