C26H29ClN2O4 — CID 4714406
[[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate (PubChem CID 4714406) has the molecular formula C26H29ClN2O4 and a molecular weight of 468.98 g/mol. Its IUPAC name is [[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate.
| Compound Name | [[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4714406 |
| Molecular Formula | C26H29ClN2O4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C2CC3(C(=O)Nc4ccc(Cl)cc4C)CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C26H29ClN2O4/c1-16-14-18(27)8-11-20(16)28-23(31)26-13-12-25(4,24(26,2)3)21(15-26)29-33-22(30)17-6-9-19(32-5)10-7-17/h6-11,14H,12-13,15H2,1-5H3,(H,28,31) |
| InChIKey | IMIHFIAZZLCZBZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|