C24H23BrCl2N2O3 — CID 4714636
[[4-[(2,3-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate (PubChem CID 4714636) has the molecular formula C24H23BrCl2N2O3 and a molecular weight of 538.27 g/mol. Its IUPAC name is [[4-[(2,3-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate.
| Compound Name | [[4-[(2,3-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate |
|---|---|
| PubChem CID | 4714636 |
| Molecular Formula | C24H23BrCl2N2O3 |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | [[4-[(2,3-dichlorophenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate |
| SMILES | CC12CCC(C(=O)Nc3cccc(Cl)c3Cl)(CC1=NOC(=O)c1ccc(Br)cc1)C2(C)C |
| InChI | InChI=1S/C24H23BrCl2N2O3/c1-22(2)23(3)11-12-24(22,21(31)28-17-6-4-5-16(26)19(17)27)13-18(23)29-32-20(30)14-7-9-15(25)10-8-14/h4-10H,11-13H2,1-3H3,(H,28,31) |
| InChIKey | ICECJBCNEJFQKJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|