C25H26BrClN2O3 — CID 6198245
[(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-bromobenzoate (PubChem CID 6198245) has the molecular formula C25H26BrClN2O3 and a molecular weight of 517.85 g/mol. Its IUPAC name is [(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-bromobenzoate.
| Compound Name | [(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-bromobenzoate |
|---|---|
| PubChem CID | 6198245 |
| Molecular Formula | C25H26BrClN2O3 |
| Molecular Weight | 517.85 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | [(Z)-[4-[(4-chloro-2-methylphenyl)carbamoyl]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2-bromobenzoate |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C12CCC(C)(/C(=N\OC(=O)c3ccccc3Br)C1)C2(C)C |
| InChI | InChI=1S/C25H26BrClN2O3/c1-15-13-16(27)9-10-19(15)28-22(31)25-12-11-24(4,23(25,2)3)20(14-25)29-32-21(30)17-7-5-6-8-18(17)26/h5-10,13H,11-12,14H2,1-4H3,(H,28,31)/b29-20- |
| InChIKey | QLIHBJQYMQUNFF-BRPDVVIDSA-N |
| XLogP | 6.78 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.85 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|