C18H20Cl2N2O3 — CID 6198335
[(Z)-(4-carbamoyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 2,4-dichlorobenzoate (PubChem CID 6198335) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is [(Z)-(4-carbamoyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 2,4-dichlorobenzoate.
| Compound Name | [(Z)-(4-carbamoyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 6198335 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [(Z)-(4-carbamoyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 2,4-dichlorobenzoate |
| SMILES | CC12CCC(C(N)=O)(C/C1=N/OC(=O)c1ccc(Cl)cc1Cl)C2(C)C |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-16(2)17(3)6-7-18(16,15(21)24)9-13(17)22-25-14(23)11-5-4-10(19)8-12(11)20/h4-5,8H,6-7,9H2,1-3H3,(H2,21,24)/b22-13- |
| InChIKey | PLOFNRGDPHYVPE-XKZIYDEJSA-N |
| XLogP | 4.21 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|