C24H22Cl3NO2 — CID 134100742
[(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate (PubChem CID 134100742) has the molecular formula C24H22Cl3NO2 and a molecular weight of 462.80 g/mol. Its IUPAC name is [(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate.
| Compound Name | [(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 134100742 |
| Molecular Formula | C24H22Cl3NO2 |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | [(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,4-dichlorobenzoate |
| SMILES | CC12CCC(C(=C\c3ccc(Cl)cc3)/C1=N/OC(=O)c1ccc(Cl)cc1Cl)C2(C)C |
| InChI | InChI=1S/C24H22Cl3NO2/c1-23(2)19-10-11-24(23,3)21(18(19)12-14-4-6-15(25)7-5-14)28-30-22(29)17-9-8-16(26)13-20(17)27/h4-9,12-13,19H,10-11H2,1-3H3/b18-12+,28-21- |
| InChIKey | RAMDGVGRJCDDFW-LUGFIXERSA-N |
| XLogP | 7.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|