C22H28ClNO2 — CID 134101852
[(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,2-dimethylpropanoate (PubChem CID 134101852) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is [(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134101852 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | [(Z)-[(3E)-3-[(4-chlorophenyl)methylidene]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O/N=C1C(=C/c2ccc(Cl)cc2)/C2CCC/1(C)C2(C)C |
| InChI | InChI=1S/C22H28ClNO2/c1-20(2,3)19(25)26-24-18-16(13-14-7-9-15(23)10-8-14)17-11-12-22(18,6)21(17,4)5/h7-10,13,17H,11-12H2,1-6H3/b16-13+,24-18- |
| InChIKey | XUJVIRZZWYEJRH-JFWIQPJLSA-N |
| XLogP | 6.12 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|