C24H31NO4 — CID 23351885
[(E)-[(1S,3E,4S)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,3-dimethylbutanoate (PubChem CID 23351885) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is [(E)-[(1S,3E,4S)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,3-dimethylbutanoate.
| Compound Name | [(E)-[(1S,3E,4S)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 23351885 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | [(E)-[(1S,3E,4S)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)O/N=C1C(=C\c2ccc3c(c2)OCO3)\[C@H]2CC[C@@]\1(C)C2(C)C |
| InChI | InChI=1S/C24H31NO4/c1-22(2,3)13-20(26)29-25-21-16(17-9-10-24(21,6)23(17,4)5)11-15-7-8-18-19(12-15)28-14-27-18/h7-8,11-12,17H,9-10,13-14H2,1-6H3/b16-11+,25-21+/t17-,24-/m1/s1 |
| InChIKey | AWFAWEQOKJLZQG-JCABICQKSA-N |
| XLogP | 5.59 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|