C19H19NO4 — CID 2728136
(1,3-benzodioxol-5-ylmethylideneamino) 4-tert-butylbenzoate (PubChem CID 2728136) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (1,3-benzodioxol-5-ylmethylideneamino) 4-tert-butylbenzoate.
| Compound Name | (1,3-benzodioxol-5-ylmethylideneamino) 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2728136 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (1,3-benzodioxol-5-ylmethylideneamino) 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)ON=Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-19(2,3)15-7-5-14(6-8-15)18(21)24-20-11-13-4-9-16-17(10-13)23-12-22-16/h4-11H,12H2,1-3H3 |
| InChIKey | ODRUJRGUCNDTGA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|