C22H26O4 — CID 3013334
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate (PubChem CID 3013334) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 3013334 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)C=CC=Cc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C22H26O4/c1-21(2)16-10-11-22(21,3)19(13-16)26-20(23)7-5-4-6-15-8-9-17-18(12-15)25-14-24-17/h4-9,12,16,19H,10-11,13-14H2,1-3H3 |
| InChIKey | PRQIQLZCTBYMPT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|