C20H26O4 — CID 163192894
[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoate (PubChem CID 163192894) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163192894 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (E)-3-(4-hydroxy-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(O)ccc1/C=C/C(=O)O[C@H]1C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C20H26O4/c1-19(2)14-9-10-20(19,3)17(11-14)24-18(22)8-6-13-5-7-15(21)12-16(13)23-4/h5-8,12,14,17,21H,9-11H2,1-4H3/b8-6+/t14-,17+,20+/m1/s1 |
| InChIKey | CPJMZTUMYSQEGK-IOYKRAMTSA-N |
| XLogP | 4.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|