C21H30O5 — CID 155630645
[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-(4-hydroxy-3,5-dimethoxyphenyl)propanoate (PubChem CID 155630645) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-(4-hydroxy-3,5-dimethoxyphenyl)propanoate.
| Compound Name | [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-(4-hydroxy-3,5-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 155630645 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-(4-hydroxy-3,5-dimethoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)O[C@H]2C[C@H]3CC[C@]2(C)C3(C)C)cc(OC)c1O |
| InChI | InChI=1S/C21H30O5/c1-20(2)14-8-9-21(20,3)17(12-14)26-18(22)7-6-13-10-15(24-4)19(23)16(11-13)25-5/h10-11,14,17,23H,6-9,12H2,1-5H3/t14-,17+,21+/m1/s1 |
| InChIKey | NUNIFPAWKKIVJX-FNXXIHLHSA-N |
| XLogP | 4.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |