C26H27NO4 — CID 22575100
[(E)-[(1R,3E,4R)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate (PubChem CID 22575100) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(E)-[(1R,3E,4R)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate.
| Compound Name | [(E)-[(1R,3E,4R)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate |
|---|---|
| PubChem CID | 22575100 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(E)-[(1R,3E,4R)-3-(1,3-benzodioxol-5-ylmethylidene)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O/N=C2C(=C\c3ccc4c(c3)OCO4)\[C@@H]3CC[C@]\2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-16-5-8-18(9-6-16)24(28)31-27-23-19(20-11-12-26(23,4)25(20,2)3)13-17-7-10-21-22(14-17)30-15-29-21/h5-10,13-14,20H,11-12,15H2,1-4H3/b19-13+,27-23+/t20-,26-/m0/s1 |
| InChIKey | VGXOTHSVUJMPMB-UOXWJKIXSA-N |
| XLogP | 5.78 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|